C19H28N4O4S — CID 22204206
2-(diethylamino)ethyl 4-[(1-ethyl-5-methylpyrazol-4-yl)sulfonylamino]benzoate (PubChem CID 22204206) has the molecular formula C19H28N4O4S and a molecular weight of 408.52 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 4-[(1-ethyl-5-methylpyrazol-4-yl)sulfonylamino]benzoate.
| Compound Name | 2-(diethylamino)ethyl 4-[(1-ethyl-5-methylpyrazol-4-yl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 22204206 |
| Molecular Formula | C19H28N4O4S |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 2-(diethylamino)ethyl 4-[(1-ethyl-5-methylpyrazol-4-yl)sulfonylamino]benzoate |
| SMILES | CCN(CC)CCOC(=O)c1ccc(NS(=O)(=O)c2cnn(CC)c2C)cc1 |
| InChI | InChI=1S/C19H28N4O4S/c1-5-22(6-2)12-13-27-19(24)16-8-10-17(11-9-16)21-28(25,26)18-14-20-23(7-3)15(18)4/h8-11,14,21H,5-7,12-13H2,1-4H3 |
| InChIKey | IGLTWPKSIBBTIN-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |