C18H23N5O3 — CID 110492639
2-(diethylamino)ethyl 4-(pyrazin-2-ylcarbamoylamino)benzoate (PubChem CID 110492639) has the molecular formula C18H23N5O3 and a molecular weight of 357.41 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 4-(pyrazin-2-ylcarbamoylamino)benzoate.
| Compound Name | 2-(diethylamino)ethyl 4-(pyrazin-2-ylcarbamoylamino)benzoate |
|---|---|
| PubChem CID | 110492639 |
| Molecular Formula | C18H23N5O3 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | 2-(diethylamino)ethyl 4-(pyrazin-2-ylcarbamoylamino)benzoate |
| SMILES | CCN(CC)CCOC(=O)c1ccc(NC(=O)Nc2cnccn2)cc1 |
| InChI | InChI=1S/C18H23N5O3/c1-3-23(4-2)11-12-26-17(24)14-5-7-15(8-6-14)21-18(25)22-16-13-19-9-10-20-16/h5-10,13H,3-4,11-12H2,1-2H3,(H2,20,21,22,25) |
| InChIKey | PEGJQGOZWISHEZ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |