C12H13F2N3O2S — CID 22773468
N-(3,4-difluorophenyl)-1-ethyl-5-methylpyrazole-4-sulfonamide (PubChem CID 22773468) has the molecular formula C12H13F2N3O2S and a molecular weight of 301.32 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-1-ethyl-5-methylpyrazole-4-sulfonamide.
| Compound Name | N-(3,4-difluorophenyl)-1-ethyl-5-methylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 22773468 |
| Molecular Formula | C12H13F2N3O2S |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | N-(3,4-difluorophenyl)-1-ethyl-5-methylpyrazole-4-sulfonamide |
| SMILES | CCn1ncc(S(=O)(=O)Nc2ccc(F)c(F)c2)c1C |
| InChI | InChI=1S/C12H13F2N3O2S/c1-3-17-8(2)12(7-15-17)20(18,19)16-9-4-5-10(13)11(14)6-9/h4-7,16H,3H2,1-2H3 |
| InChIKey | BHGSDXUWWFIDQE-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |