C18H26N4O4S2 — CID 19684585
N-[4-(azepan-1-ylsulfonyl)phenyl]-1-ethyl-5-methylpyrazole-4-sulfonamide (PubChem CID 19684585) has the molecular formula C18H26N4O4S2 and a molecular weight of 426.56 g/mol. Its IUPAC name is N-[4-(azepan-1-ylsulfonyl)phenyl]-1-ethyl-5-methylpyrazole-4-sulfonamide.
| Compound Name | N-[4-(azepan-1-ylsulfonyl)phenyl]-1-ethyl-5-methylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 19684585 |
| Molecular Formula | C18H26N4O4S2 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | N-[4-(azepan-1-ylsulfonyl)phenyl]-1-ethyl-5-methylpyrazole-4-sulfonamide |
| SMILES | CCn1ncc(S(=O)(=O)Nc2ccc(S(=O)(=O)N3CCCCCC3)cc2)c1C |
| InChI | InChI=1S/C18H26N4O4S2/c1-3-22-15(2)18(14-19-22)27(23,24)20-16-8-10-17(11-9-16)28(25,26)21-12-6-4-5-7-13-21/h8-11,14,20H,3-7,12-13H2,1-2H3 |
| InChIKey | IDZNRHNYLWTPAW-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |