C15H20N4O4S2 — CID 22203361
1,5-dimethyl-N-(4-pyrrolidin-1-ylsulfonylphenyl)pyrazole-4-sulfonamide (PubChem CID 22203361) has the molecular formula C15H20N4O4S2 and a molecular weight of 384.48 g/mol. Its IUPAC name is 1,5-dimethyl-N-(4-pyrrolidin-1-ylsulfonylphenyl)pyrazole-4-sulfonamide.
| Compound Name | 1,5-dimethyl-N-(4-pyrrolidin-1-ylsulfonylphenyl)pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 22203361 |
| Molecular Formula | C15H20N4O4S2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | 1,5-dimethyl-N-(4-pyrrolidin-1-ylsulfonylphenyl)pyrazole-4-sulfonamide |
| SMILES | Cc1c(S(=O)(=O)Nc2ccc(S(=O)(=O)N3CCCC3)cc2)cnn1C |
| InChI | InChI=1S/C15H20N4O4S2/c1-12-15(11-16-18(12)2)24(20,21)17-13-5-7-14(8-6-13)25(22,23)19-9-3-4-10-19/h5-8,11,17H,3-4,9-10H2,1-2H3 |
| InChIKey | ZFVKTYQMEYZHIN-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |