C13H17N3O3S — CID 22774219
N-(4-ethoxyphenyl)-1,5-dimethylpyrazole-4-sulfonamide (PubChem CID 22774219) has the molecular formula C13H17N3O3S and a molecular weight of 295.36 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-1,5-dimethylpyrazole-4-sulfonamide.
| Compound Name | N-(4-ethoxyphenyl)-1,5-dimethylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 22774219 |
| Molecular Formula | C13H17N3O3S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | N-(4-ethoxyphenyl)-1,5-dimethylpyrazole-4-sulfonamide |
| SMILES | CCOc1ccc(NS(=O)(=O)c2cnn(C)c2C)cc1 |
| InChI | InChI=1S/C13H17N3O3S/c1-4-19-12-7-5-11(6-8-12)15-20(17,18)13-9-14-16(3)10(13)2/h5-9,15H,4H2,1-3H3 |
| InChIKey | PSFZZLFVVXRJSF-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |