C15H20N4O3S — CID 6471033
N-[4-[(1-ethyl-5-methylpyrazol-4-yl)sulfonylamino]phenyl]-N-methylacetamide (PubChem CID 6471033) has the molecular formula C15H20N4O3S and a molecular weight of 336.42 g/mol. Its IUPAC name is N-[4-[(1-ethyl-5-methylpyrazol-4-yl)sulfonylamino]phenyl]-N-methylacetamide.
| Compound Name | N-[4-[(1-ethyl-5-methylpyrazol-4-yl)sulfonylamino]phenyl]-N-methylacetamide |
|---|---|
| PubChem CID | 6471033 |
| Molecular Formula | C15H20N4O3S |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | N-[4-[(1-ethyl-5-methylpyrazol-4-yl)sulfonylamino]phenyl]-N-methylacetamide |
| SMILES | CCn1ncc(S(=O)(=O)Nc2ccc(N(C)C(C)=O)cc2)c1C |
| InChI | InChI=1S/C15H20N4O3S/c1-5-19-11(2)15(10-16-19)23(21,22)17-13-6-8-14(9-7-13)18(4)12(3)20/h6-10,17H,5H2,1-4H3 |
| InChIKey | OICPUBCEIVJNQO-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |