C19H22N4O5S2 — CID 22202841
1-ethyl-N-[4-[(2-methoxyphenyl)sulfamoyl]phenyl]-5-methylpyrazole-4-sulfonamide (PubChem CID 22202841) has the molecular formula C19H22N4O5S2 and a molecular weight of 450.54 g/mol. Its IUPAC name is 1-ethyl-N-[4-[(2-methoxyphenyl)sulfamoyl]phenyl]-5-methylpyrazole-4-sulfonamide.
| Compound Name | 1-ethyl-N-[4-[(2-methoxyphenyl)sulfamoyl]phenyl]-5-methylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 22202841 |
| Molecular Formula | C19H22N4O5S2 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.10 |
| IUPAC Name | 1-ethyl-N-[4-[(2-methoxyphenyl)sulfamoyl]phenyl]-5-methylpyrazole-4-sulfonamide |
| SMILES | CCn1ncc(S(=O)(=O)Nc2ccc(S(=O)(=O)Nc3ccccc3OC)cc2)c1C |
| InChI | InChI=1S/C19H22N4O5S2/c1-4-23-14(2)19(13-20-23)30(26,27)21-15-9-11-16(12-10-15)29(24,25)22-17-7-5-6-8-18(17)28-3/h5-13,21-22H,4H2,1-3H3 |
| InChIKey | SDNOZWHHYLVGHZ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 119.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |