C17H15ClN2O3S — CID 171822694
4-chloro-2,5-dimethyl-N-[3-(1,3-oxazol-2-yl)phenyl]benzenesulfonamide (PubChem CID 171822694) has the molecular formula C17H15ClN2O3S and a molecular weight of 362.84 g/mol. Its IUPAC name is 4-chloro-2,5-dimethyl-N-[3-(1,3-oxazol-2-yl)phenyl]benzenesulfonamide.
| Compound Name | 4-chloro-2,5-dimethyl-N-[3-(1,3-oxazol-2-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 171822694 |
| Molecular Formula | C17H15ClN2O3S |
| Molecular Weight | 362.84 g/mol |
| Exact Mass | 362.05 |
| IUPAC Name | 4-chloro-2,5-dimethyl-N-[3-(1,3-oxazol-2-yl)phenyl]benzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)Nc2cccc(-c3ncco3)c2)c(C)cc1Cl |
| InChI | InChI=1S/C17H15ClN2O3S/c1-11-9-16(12(2)8-15(11)18)24(21,22)20-14-5-3-4-13(10-14)17-19-6-7-23-17/h3-10,20H,1-2H3 |
| InChIKey | HMOZMZAHUPPEGL-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.84 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |