C10H9IN4O4S — CID 103962635
2-iodo-5-[(2-methyl-1,2,4-triazol-3-yl)sulfamoyl]benzoic acid (PubChem CID 103962635) has the molecular formula C10H9IN4O4S and a molecular weight of 408.18 g/mol. Its IUPAC name is 2-iodo-5-[(2-methyl-1,2,4-triazol-3-yl)sulfamoyl]benzoic acid.
| Compound Name | 2-iodo-5-[(2-methyl-1,2,4-triazol-3-yl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 103962635 |
| Molecular Formula | C10H9IN4O4S |
| Molecular Weight | 408.18 g/mol |
| Exact Mass | 407.94 |
| IUPAC Name | 2-iodo-5-[(2-methyl-1,2,4-triazol-3-yl)sulfamoyl]benzoic acid |
| SMILES | Cn1ncnc1NS(=O)(=O)c1ccc(I)c(C(=O)O)c1 |
| InChI | InChI=1S/C10H9IN4O4S/c1-15-10(12-5-13-15)14-20(18,19)6-2-3-8(11)7(4-6)9(16)17/h2-5H,1H3,(H,16,17)(H,12,13,14) |
| InChIKey | BSSSIGCOBGQOTE-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.18 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|