About 2-bromo-4,6-difluoro-N-(4-methyl-1H-pyrazol-5-yl)benzenesulfonamide
2-bromo-4,6-difluoro-N-(4-methyl-1H-pyrazol-5-yl)benzenesulfonamide (PubChem CID 113237176) has the molecular formula C10H8BrF2N3O2S
and a molecular weight of 352.16 g/mol. Its IUPAC name is 2-bromo-4,6-difluoro-N-(4-methyl-1H-pyrazol-5-yl)benzenesulfonamide.
Molecular Properties
| Compound Name | 2-bromo-4,6-difluoro-N-(4-methyl-1H-pyrazol-5-yl)benzenesulfonamide |
| PubChem CID | 113237176 |
| Molecular Formula | C10H8BrF2N3O2S |
| Molecular Weight | 352.16 g/mol |
| Exact Mass | 350.95 |
| IUPAC Name | 2-bromo-4,6-difluoro-N-(4-methyl-1H-pyrazol-5-yl)benzenesulfonamide |
| SMILES | Cc1cn[nH]c1NS(=O)(=O)c1c(F)cc(F)cc1Br |
| InChI | InChI=1S/C10H8BrF2N3O2S/c1-5-4-14-15-10(5)16-19(17,18)9-7(11)2-6(12)3-8(9)13/h2-4H,1H3,(H2,14,15,16) |
| InChIKey | MAJKXXJUPUOAHN-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.16 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-bromo-4,6-difluoro-N-(4-methyl-1H-pyrazol-5-yl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-4,6-difluoro-N-(4-methyl-1H-pyrazol-5-yl)benzenesulfonamide?
The IUPAC name of 2-bromo-4,6-difluoro-N-(4-methyl-1H-pyrazol-5-yl)benzenesulfonamide (CID 113237176) is 2-bromo-4,6-difluoro-N-(4-methyl-1H-pyrazol-5-yl)benzenesulfonamide.
What is the SMILES notation for 2-bromo-4,6-difluoro-N-(4-methyl-1H-pyrazol-5-yl)benzenesulfonamide?
The canonical SMILES for 2-bromo-4,6-difluoro-N-(4-methyl-1H-pyrazol-5-yl)benzenesulfonamide is Cc1cn[nH]c1NS(=O)(=O)c1c(F)cc(F)cc1Br.
What is the InChIKey of 2-bromo-4,6-difluoro-N-(4-methyl-1H-pyrazol-5-yl)benzenesulfonamide?
The InChIKey is MAJKXXJUPUOAHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8BrF2N3O2S/c1-5-4-14-15-10(5)16-19(17,18)9-7(11)2-6(12)3-8(9)13/h2-4H,1H3,(H2,14,15,16).
What are the key properties of 2-bromo-4,6-difluoro-N-(4-methyl-1H-pyrazol-5-yl)benzenesulfonamide?
2-bromo-4,6-difluoro-N-(4-methyl-1H-pyrazol-5-yl)benzenesulfonamide has a molecular weight of 352.16 g/mol, XLogP of 2.56, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-4,6-difluoro-N-(4-methyl-1H-pyrazol-5-yl)benzenesulfonamide is sourced from PubChem (CID 113237176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).