C11H13F2N — CID 43123985
N-(1-cyclopropylethyl)-2,6-difluoroaniline (PubChem CID 43123985) has the molecular formula C11H13F2N and a molecular weight of 197.23 g/mol. Its IUPAC name is N-(1-cyclopropylethyl)-2,6-difluoroaniline.
| Compound Name | N-(1-cyclopropylethyl)-2,6-difluoroaniline |
|---|---|
| PubChem CID | 43123985 |
| Molecular Formula | C11H13F2N |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | N-(1-cyclopropylethyl)-2,6-difluoroaniline |
| SMILES | CC(Nc1c(F)cccc1F)C1CC1 |
| InChI | InChI=1S/C11H13F2N/c1-7(8-5-6-8)14-11-9(12)3-2-4-10(11)13/h2-4,7-8,14H,5-6H2,1H3 |
| InChIKey | IRMPEFAALCDDPZ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |