C16H14ClF2N — CID 43773132
N-[(4-chlorophenyl)-cyclopropylmethyl]-2,6-difluoroaniline (PubChem CID 43773132) has the molecular formula C16H14ClF2N and a molecular weight of 293.74 g/mol. Its IUPAC name is N-[(4-chlorophenyl)-cyclopropylmethyl]-2,6-difluoroaniline.
| Compound Name | N-[(4-chlorophenyl)-cyclopropylmethyl]-2,6-difluoroaniline |
|---|---|
| PubChem CID | 43773132 |
| Molecular Formula | C16H14ClF2N |
| Molecular Weight | 293.74 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | N-[(4-chlorophenyl)-cyclopropylmethyl]-2,6-difluoroaniline |
| SMILES | Fc1cccc(F)c1NC(c1ccc(Cl)cc1)C1CC1 |
| InChI | InChI=1S/C16H14ClF2N/c17-12-8-6-11(7-9-12)15(10-4-5-10)20-16-13(18)2-1-3-14(16)19/h1-3,6-10,15,20H,4-5H2 |
| InChIKey | NEEHPAFFCNTCRP-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.74 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |