C17H14ClFN2 — CID 43222298
2-[[(4-chlorophenyl)-cyclopropylmethyl]amino]-6-fluorobenzonitrile (PubChem CID 43222298) has the molecular formula C17H14ClFN2 and a molecular weight of 300.76 g/mol. Its IUPAC name is 2-[[(4-chlorophenyl)-cyclopropylmethyl]amino]-6-fluorobenzonitrile.
| Compound Name | 2-[[(4-chlorophenyl)-cyclopropylmethyl]amino]-6-fluorobenzonitrile |
|---|---|
| PubChem CID | 43222298 |
| Molecular Formula | C17H14ClFN2 |
| Molecular Weight | 300.76 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 2-[[(4-chlorophenyl)-cyclopropylmethyl]amino]-6-fluorobenzonitrile |
| SMILES | N#Cc1c(F)cccc1NC(c1ccc(Cl)cc1)C1CC1 |
| InChI | InChI=1S/C17H14ClFN2/c18-13-8-6-12(7-9-13)17(11-4-5-11)21-16-3-1-2-15(19)14(16)10-20/h1-3,6-9,11,17,21H,4-5H2 |
| InChIKey | AKDPFFGUEZEPPR-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.76 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |