C12H14ClF3N2O3S — CID 124721813
2-chloro-N-[(1S,2S)-2-hydroxycyclohexyl]-6-(trifluoromethyl)pyridine-3-sulfonamide (PubChem CID 124721813) has the molecular formula C12H14ClF3N2O3S and a molecular weight of 358.77 g/mol. Its IUPAC name is 2-chloro-N-[(1S,2S)-2-hydroxycyclohexyl]-6-(trifluoromethyl)pyridine-3-sulfonamide.
| Compound Name | 2-chloro-N-[(1S,2S)-2-hydroxycyclohexyl]-6-(trifluoromethyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 124721813 |
| Molecular Formula | C12H14ClF3N2O3S |
| Molecular Weight | 358.77 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | 2-chloro-N-[(1S,2S)-2-hydroxycyclohexyl]-6-(trifluoromethyl)pyridine-3-sulfonamide |
| SMILES | O=S(=O)(N[C@H]1CCCC[C@@H]1O)c1ccc(C(F)(F)F)nc1Cl |
| InChI | InChI=1S/C12H14ClF3N2O3S/c13-11-9(5-6-10(17-11)12(14,15)16)22(20,21)18-7-3-1-2-4-8(7)19/h5-8,18-19H,1-4H2/t7-,8-/m0/s1 |
| InChIKey | AIKCKYVJUMNOTG-YUMQZZPRSA-N |
| XLogP | 2.34 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.77 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|