C13H19ClN2O4S — CID 119964550
methyl 2-(piperidin-3-ylsulfamoyl)benzoate;hydrochloride (PubChem CID 119964550) has the molecular formula C13H19ClN2O4S and a molecular weight of 334.83 g/mol. Its IUPAC name is methyl 2-(piperidin-3-ylsulfamoyl)benzoate;hydrochloride.
| Compound Name | methyl 2-(piperidin-3-ylsulfamoyl)benzoate;hydrochloride |
|---|---|
| PubChem CID | 119964550 |
| Molecular Formula | C13H19ClN2O4S |
| Molecular Weight | 334.83 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | methyl 2-(piperidin-3-ylsulfamoyl)benzoate;hydrochloride |
| SMILES | COC(=O)c1ccccc1S(=O)(=O)NC1CCCNC1.Cl |
| InChI | InChI=1S/C13H18N2O4S.ClH/c1-19-13(16)11-6-2-3-7-12(11)20(17,18)15-10-5-4-8-14-9-10;/h2-3,6-7,10,14-15H,4-5,8-9H2,1H3;1H |
| InChIKey | OTTVNHBHACLXAE-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.83 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |