C15H23N3O4S2 — CID 120707123
N-piperidin-3-yl-2-pyrrolidin-1-ylsulfonylbenzenesulfonamide (PubChem CID 120707123) has the molecular formula C15H23N3O4S2 and a molecular weight of 373.50 g/mol. Its IUPAC name is N-piperidin-3-yl-2-pyrrolidin-1-ylsulfonylbenzenesulfonamide.
| Compound Name | N-piperidin-3-yl-2-pyrrolidin-1-ylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 120707123 |
| Molecular Formula | C15H23N3O4S2 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | N-piperidin-3-yl-2-pyrrolidin-1-ylsulfonylbenzenesulfonamide |
| SMILES | O=S(=O)(NC1CCCNC1)c1ccccc1S(=O)(=O)N1CCCC1 |
| InChI | InChI=1S/C15H23N3O4S2/c19-23(20,17-13-6-5-9-16-12-13)14-7-1-2-8-15(14)24(21,22)18-10-3-4-11-18/h1-2,7-8,13,16-17H,3-6,9-12H2 |
| InChIKey | WQPRCUJGYSRKED-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |