C11H14BrClN2O2S — CID 120999547
2-bromo-6-chloro-N-piperidin-3-ylbenzenesulfonamide (PubChem CID 120999547) has the molecular formula C11H14BrClN2O2S and a molecular weight of 353.67 g/mol. Its IUPAC name is 2-bromo-6-chloro-N-piperidin-3-ylbenzenesulfonamide.
| Compound Name | 2-bromo-6-chloro-N-piperidin-3-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 120999547 |
| Molecular Formula | C11H14BrClN2O2S |
| Molecular Weight | 353.67 g/mol |
| Exact Mass | 351.96 |
| IUPAC Name | 2-bromo-6-chloro-N-piperidin-3-ylbenzenesulfonamide |
| SMILES | O=S(=O)(NC1CCCNC1)c1c(Cl)cccc1Br |
| InChI | InChI=1S/C11H14BrClN2O2S/c12-9-4-1-5-10(13)11(9)18(16,17)15-8-3-2-6-14-7-8/h1,4-5,8,14-15H,2-3,6-7H2 |
| InChIKey | OIGATBLYIOLZSY-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.67 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |