C17H20N2O5S — CID 9453559
3-(cyclopropylsulfamoyl)-N-[(1R)-1-(furan-2-yl)ethyl]-4-methoxybenzamide (PubChem CID 9453559) has the molecular formula C17H20N2O5S and a molecular weight of 364.42 g/mol. Its IUPAC name is 3-(cyclopropylsulfamoyl)-N-[(1R)-1-(furan-2-yl)ethyl]-4-methoxybenzamide.
| Compound Name | 3-(cyclopropylsulfamoyl)-N-[(1R)-1-(furan-2-yl)ethyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 9453559 |
| Molecular Formula | C17H20N2O5S |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 3-(cyclopropylsulfamoyl)-N-[(1R)-1-(furan-2-yl)ethyl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)N[C@H](C)c2ccco2)cc1S(=O)(=O)NC1CC1 |
| InChI | InChI=1S/C17H20N2O5S/c1-11(14-4-3-9-24-14)18-17(20)12-5-8-15(23-2)16(10-12)25(21,22)19-13-6-7-13/h3-5,8-11,13,19H,6-7H2,1-2H3,(H,18,20)/t11-/m1/s1 |
| InChIKey | JTSKREQRGSKAKG-LLVKDONJSA-N |
| XLogP | 2.22 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |