C26H25N3O5S — CID 3622606
3-(3,4-dimethoxyphenyl)-N-[[[2-(2-phenylphenoxy)acetyl]amino]carbamothioyl]prop-2-enamide (PubChem CID 3622606) has the molecular formula C26H25N3O5S and a molecular weight of 491.57 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-N-[[[2-(2-phenylphenoxy)acetyl]amino]carbamothioyl]prop-2-enamide.
| Compound Name | 3-(3,4-dimethoxyphenyl)-N-[[[2-(2-phenylphenoxy)acetyl]amino]carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 3622606 |
| Molecular Formula | C26H25N3O5S |
| Molecular Weight | 491.57 g/mol |
| Exact Mass | 491.15 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-N-[[[2-(2-phenylphenoxy)acetyl]amino]carbamothioyl]prop-2-enamide |
| SMILES | COc1ccc(C=CC(=O)NC(=S)NNC(=O)COc2ccccc2-c2ccccc2)cc1OC |
| InChI | InChI=1S/C26H25N3O5S/c1-32-22-14-12-18(16-23(22)33-2)13-15-24(30)27-26(35)29-28-25(31)17-34-21-11-7-6-10-20(21)19-8-4-3-5-9-19/h3-16H,17H2,1-2H3,(H,28,31)(H2,27,29,30,35) |
| InChIKey | KKGAQVYANCEBEN-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.57 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|