C22H24BrN3O5S — CID 3363683
N-[[[2-(2-bromo-4-ethylphenoxy)acetyl]amino]carbamothioyl]-3-(3,4-dimethoxyphenyl)prop-2-enamide (PubChem CID 3363683) has the molecular formula C22H24BrN3O5S and a molecular weight of 522.42 g/mol. Its IUPAC name is N-[[[2-(2-bromo-4-ethylphenoxy)acetyl]amino]carbamothioyl]-3-(3,4-dimethoxyphenyl)prop-2-enamide.
| Compound Name | N-[[[2-(2-bromo-4-ethylphenoxy)acetyl]amino]carbamothioyl]-3-(3,4-dimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 3363683 |
| Molecular Formula | C22H24BrN3O5S |
| Molecular Weight | 522.42 g/mol |
| Exact Mass | 521.06 |
| IUPAC Name | N-[[[2-(2-bromo-4-ethylphenoxy)acetyl]amino]carbamothioyl]-3-(3,4-dimethoxyphenyl)prop-2-enamide |
| SMILES | CCc1ccc(OCC(=O)NNC(=S)NC(=O)C=Cc2ccc(OC)c(OC)c2)c(Br)c1 |
| InChI | InChI=1S/C22H24BrN3O5S/c1-4-14-5-8-17(16(23)11-14)31-13-21(28)25-26-22(32)24-20(27)10-7-15-6-9-18(29-2)19(12-15)30-3/h5-12H,4,13H2,1-3H3,(H,25,28)(H2,24,26,27,32) |
| InChIKey | QPYVZECRZFKFDQ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.42 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|