C25H20N4O3 — CID 26840468
(E)-N'-[2-(2-phenylphenoxy)acetyl]-3-quinoxalin-2-ylprop-2-enehydrazide (PubChem CID 26840468) has the molecular formula C25H20N4O3 and a molecular weight of 424.46 g/mol. Its IUPAC name is (E)-N'-[2-(2-phenylphenoxy)acetyl]-3-quinoxalin-2-ylprop-2-enehydrazide.
| Compound Name | (E)-N'-[2-(2-phenylphenoxy)acetyl]-3-quinoxalin-2-ylprop-2-enehydrazide |
|---|---|
| PubChem CID | 26840468 |
| Molecular Formula | C25H20N4O3 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | (E)-N'-[2-(2-phenylphenoxy)acetyl]-3-quinoxalin-2-ylprop-2-enehydrazide |
| SMILES | O=C(/C=C/c1cnc2ccccc2n1)NNC(=O)COc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C25H20N4O3/c30-24(15-14-19-16-26-21-11-5-6-12-22(21)27-19)28-29-25(31)17-32-23-13-7-4-10-20(23)18-8-2-1-3-9-18/h1-16H,17H2,(H,28,30)(H,29,31)/b15-14+ |
| InChIKey | YHWUQWPXBABPFG-CCEZHUSRSA-N |
| XLogP | 3.54 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|