C15H18ClN3O3S2 — CID 119465707
N-[3-(2-aminoethylsulfamoyl)phenyl]-3-(4-chlorothiophen-2-yl)propanamide (PubChem CID 119465707) has the molecular formula C15H18ClN3O3S2 and a molecular weight of 387.91 g/mol. Its IUPAC name is N-[3-(2-aminoethylsulfamoyl)phenyl]-3-(4-chlorothiophen-2-yl)propanamide.
| Compound Name | N-[3-(2-aminoethylsulfamoyl)phenyl]-3-(4-chlorothiophen-2-yl)propanamide |
|---|---|
| PubChem CID | 119465707 |
| Molecular Formula | C15H18ClN3O3S2 |
| Molecular Weight | 387.91 g/mol |
| Exact Mass | 387.05 |
| IUPAC Name | N-[3-(2-aminoethylsulfamoyl)phenyl]-3-(4-chlorothiophen-2-yl)propanamide |
| SMILES | NCCNS(=O)(=O)c1cccc(NC(=O)CCc2cc(Cl)cs2)c1 |
| InChI | InChI=1S/C15H18ClN3O3S2/c16-11-8-13(23-10-11)4-5-15(20)19-12-2-1-3-14(9-12)24(21,22)18-7-6-17/h1-3,8-10,18H,4-7,17H2,(H,19,20) |
| InChIKey | GDYRUQFKEMOTAL-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.91 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |