C16H25ClN4O5S — CID 119465990
N-[3-(2-aminoethylsulfamoyl)phenyl]-4-morpholin-4-yl-4-oxobutanamide;hydrochloride (PubChem CID 119465990) has the molecular formula C16H25ClN4O5S and a molecular weight of 420.92 g/mol. Its IUPAC name is N-[3-(2-aminoethylsulfamoyl)phenyl]-4-morpholin-4-yl-4-oxobutanamide;hydrochloride.
| Compound Name | N-[3-(2-aminoethylsulfamoyl)phenyl]-4-morpholin-4-yl-4-oxobutanamide;hydrochloride |
|---|---|
| PubChem CID | 119465990 |
| Molecular Formula | C16H25ClN4O5S |
| Molecular Weight | 420.92 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | N-[3-(2-aminoethylsulfamoyl)phenyl]-4-morpholin-4-yl-4-oxobutanamide;hydrochloride |
| SMILES | Cl.NCCNS(=O)(=O)c1cccc(NC(=O)CCC(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C16H24N4O5S.ClH/c17-6-7-18-26(23,24)14-3-1-2-13(12-14)19-15(21)4-5-16(22)20-8-10-25-11-9-20;/h1-3,12,18H,4-11,17H2,(H,19,21);1H |
| InChIKey | DITLBDXTVFRZBN-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.92 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |