C17H15F3N4O4S — CID 35559988
N-[3-(furan-2-ylmethylsulfamoyl)phenyl]-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide (PubChem CID 35559988) has the molecular formula C17H15F3N4O4S and a molecular weight of 428.39 g/mol. Its IUPAC name is N-[3-(furan-2-ylmethylsulfamoyl)phenyl]-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide.
| Compound Name | N-[3-(furan-2-ylmethylsulfamoyl)phenyl]-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide |
|---|---|
| PubChem CID | 35559988 |
| Molecular Formula | C17H15F3N4O4S |
| Molecular Weight | 428.39 g/mol |
| Exact Mass | 428.08 |
| IUPAC Name | N-[3-(furan-2-ylmethylsulfamoyl)phenyl]-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide |
| SMILES | O=C(Cn1ccc(C(F)(F)F)n1)Nc1cccc(S(=O)(=O)NCc2ccco2)c1 |
| InChI | InChI=1S/C17H15F3N4O4S/c18-17(19,20)15-6-7-24(23-15)11-16(25)22-12-3-1-5-14(9-12)29(26,27)21-10-13-4-2-8-28-13/h1-9,21H,10-11H2,(H,22,25) |
| InChIKey | PBKTUWXLDOBCBF-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 106.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.39 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |