C11H16BrN3O3S2 — CID 110407051
5-bromo-N-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]thiophene-2-sulfonamide (PubChem CID 110407051) has the molecular formula C11H16BrN3O3S2 and a molecular weight of 382.31 g/mol. Its IUPAC name is 5-bromo-N-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]thiophene-2-sulfonamide.
| Compound Name | 5-bromo-N-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 110407051 |
| Molecular Formula | C11H16BrN3O3S2 |
| Molecular Weight | 382.31 g/mol |
| Exact Mass | 380.98 |
| IUPAC Name | 5-bromo-N-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]thiophene-2-sulfonamide |
| SMILES | CN1CCN(C(=O)CNS(=O)(=O)c2ccc(Br)s2)CC1 |
| InChI | InChI=1S/C11H16BrN3O3S2/c1-14-4-6-15(7-5-14)10(16)8-13-20(17,18)11-3-2-9(12)19-11/h2-3,13H,4-8H2,1H3 |
| InChIKey | GXKANBYABFQWCL-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.31 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |