C17H18BrN3O4S2 — CID 41172425
4-[(5-bromothiophen-2-yl)sulfonylamino]-N-(2-oxo-2-pyrrolidin-1-ylethyl)benzamide (PubChem CID 41172425) has the molecular formula C17H18BrN3O4S2 and a molecular weight of 472.39 g/mol. Its IUPAC name is 4-[(5-bromothiophen-2-yl)sulfonylamino]-N-(2-oxo-2-pyrrolidin-1-ylethyl)benzamide.
| Compound Name | 4-[(5-bromothiophen-2-yl)sulfonylamino]-N-(2-oxo-2-pyrrolidin-1-ylethyl)benzamide |
|---|---|
| PubChem CID | 41172425 |
| Molecular Formula | C17H18BrN3O4S2 |
| Molecular Weight | 472.39 g/mol |
| Exact Mass | 470.99 |
| IUPAC Name | 4-[(5-bromothiophen-2-yl)sulfonylamino]-N-(2-oxo-2-pyrrolidin-1-ylethyl)benzamide |
| SMILES | O=C(NCC(=O)N1CCCC1)c1ccc(NS(=O)(=O)c2ccc(Br)s2)cc1 |
| InChI | InChI=1S/C17H18BrN3O4S2/c18-14-7-8-16(26-14)27(24,25)20-13-5-3-12(4-6-13)17(23)19-11-15(22)21-9-1-2-10-21/h3-8,20H,1-2,9-11H2,(H,19,23) |
| InChIKey | YWSJZXAPIFSXLE-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.39 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |