C16H20N2O3S2 — CID 112992219
2-[(5-ethylthiophen-2-yl)sulfonylamino]-N-[(3-methylphenyl)methyl]acetamide (PubChem CID 112992219) has the molecular formula C16H20N2O3S2 and a molecular weight of 352.48 g/mol. Its IUPAC name is 2-[(5-ethylthiophen-2-yl)sulfonylamino]-N-[(3-methylphenyl)methyl]acetamide.
| Compound Name | 2-[(5-ethylthiophen-2-yl)sulfonylamino]-N-[(3-methylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 112992219 |
| Molecular Formula | C16H20N2O3S2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | 2-[(5-ethylthiophen-2-yl)sulfonylamino]-N-[(3-methylphenyl)methyl]acetamide |
| SMILES | CCc1ccc(S(=O)(=O)NCC(=O)NCc2cccc(C)c2)s1 |
| InChI | InChI=1S/C16H20N2O3S2/c1-3-14-7-8-16(22-14)23(20,21)18-11-15(19)17-10-13-6-4-5-12(2)9-13/h4-9,18H,3,10-11H2,1-2H3,(H,17,19) |
| InChIKey | BYGFKJYKOCENRW-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |