C14H17BrN2O4S3 — CID 2206115
5-bromo-N-[4-(diethylsulfamoyl)phenyl]thiophene-2-sulfonamide (PubChem CID 2206115) has the molecular formula C14H17BrN2O4S3 and a molecular weight of 453.41 g/mol. Its IUPAC name is 5-bromo-N-[4-(diethylsulfamoyl)phenyl]thiophene-2-sulfonamide.
| Compound Name | 5-bromo-N-[4-(diethylsulfamoyl)phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 2206115 |
| Molecular Formula | C14H17BrN2O4S3 |
| Molecular Weight | 453.41 g/mol |
| Exact Mass | 451.95 |
| IUPAC Name | 5-bromo-N-[4-(diethylsulfamoyl)phenyl]thiophene-2-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(NS(=O)(=O)c2ccc(Br)s2)cc1 |
| InChI | InChI=1S/C14H17BrN2O4S3/c1-3-17(4-2)24(20,21)12-7-5-11(6-8-12)16-23(18,19)14-10-9-13(15)22-14/h5-10,16H,3-4H2,1-2H3 |
| InChIKey | MTBIPUBEWXYHFZ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.41 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |