C10H12F3NO4S — CID 170128451
4-hydroxy-N-(4,4,4-trifluoro-1-hydroxybutyl)benzenesulfonamide (PubChem CID 170128451) has the molecular formula C10H12F3NO4S and a molecular weight of 299.27 g/mol. Its IUPAC name is 4-hydroxy-N-(4,4,4-trifluoro-1-hydroxybutyl)benzenesulfonamide.
| Compound Name | 4-hydroxy-N-(4,4,4-trifluoro-1-hydroxybutyl)benzenesulfonamide |
|---|---|
| PubChem CID | 170128451 |
| Molecular Formula | C10H12F3NO4S |
| Molecular Weight | 299.27 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | 4-hydroxy-N-(4,4,4-trifluoro-1-hydroxybutyl)benzenesulfonamide |
| SMILES | O=S(=O)(NC(O)CCC(F)(F)F)c1ccc(O)cc1 |
| InChI | InChI=1S/C10H12F3NO4S/c11-10(12,13)6-5-9(16)14-19(17,18)8-3-1-7(15)2-4-8/h1-4,9,14-16H,5-6H2 |
| InChIKey | GFBTZTVAHOEGMG-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.27 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|