C14H13ClN2O2S2 — CID 79185686
N-[(5-chlorothiophen-2-yl)methyl]-4-(cyanomethyl)-N-methylbenzenesulfonamide (PubChem CID 79185686) has the molecular formula C14H13ClN2O2S2 and a molecular weight of 340.86 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)methyl]-4-(cyanomethyl)-N-methylbenzenesulfonamide.
| Compound Name | N-[(5-chlorothiophen-2-yl)methyl]-4-(cyanomethyl)-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 79185686 |
| Molecular Formula | C14H13ClN2O2S2 |
| Molecular Weight | 340.86 g/mol |
| Exact Mass | 340.01 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)methyl]-4-(cyanomethyl)-N-methylbenzenesulfonamide |
| SMILES | CN(Cc1ccc(Cl)s1)S(=O)(=O)c1ccc(CC#N)cc1 |
| InChI | InChI=1S/C14H13ClN2O2S2/c1-17(10-12-4-7-14(15)20-12)21(18,19)13-5-2-11(3-6-13)8-9-16/h2-7H,8,10H2,1H3 |
| InChIKey | UNCFBDJLXYUSMC-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.86 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |