C14H21N3O2S — CID 79195632
4-(cyanomethyl)-N-[3-(dimethylamino)propyl]-N-methylbenzenesulfonamide (PubChem CID 79195632) has the molecular formula C14H21N3O2S and a molecular weight of 295.41 g/mol. Its IUPAC name is 4-(cyanomethyl)-N-[3-(dimethylamino)propyl]-N-methylbenzenesulfonamide.
| Compound Name | 4-(cyanomethyl)-N-[3-(dimethylamino)propyl]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 79195632 |
| Molecular Formula | C14H21N3O2S |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 4-(cyanomethyl)-N-[3-(dimethylamino)propyl]-N-methylbenzenesulfonamide |
| SMILES | CN(C)CCCN(C)S(=O)(=O)c1ccc(CC#N)cc1 |
| InChI | InChI=1S/C14H21N3O2S/c1-16(2)11-4-12-17(3)20(18,19)14-7-5-13(6-8-14)9-10-15/h5-8H,4,9,11-12H2,1-3H3 |
| InChIKey | MDBDVUMQTXSWNC-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |