C12H14ClN3O2S2 — CID 62159075
N-[(5-chlorothiophen-2-yl)methyl]-N-methyl-2-(methylamino)pyridine-3-sulfonamide (PubChem CID 62159075) has the molecular formula C12H14ClN3O2S2 and a molecular weight of 331.85 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)methyl]-N-methyl-2-(methylamino)pyridine-3-sulfonamide.
| Compound Name | N-[(5-chlorothiophen-2-yl)methyl]-N-methyl-2-(methylamino)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 62159075 |
| Molecular Formula | C12H14ClN3O2S2 |
| Molecular Weight | 331.85 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)methyl]-N-methyl-2-(methylamino)pyridine-3-sulfonamide |
| SMILES | CNc1ncccc1S(=O)(=O)N(C)Cc1ccc(Cl)s1 |
| InChI | InChI=1S/C12H14ClN3O2S2/c1-14-12-10(4-3-7-15-12)20(17,18)16(2)8-9-5-6-11(13)19-9/h3-7H,8H2,1-2H3,(H,14,15) |
| InChIKey | PMUHEFZUIREKHA-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.85 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |