C12H21N3O2S2 — CID 112664021
N-methyl-2-(methylamino)-N-(1-methylsulfanylbutan-2-yl)pyridine-3-sulfonamide (PubChem CID 112664021) has the molecular formula C12H21N3O2S2 and a molecular weight of 303.45 g/mol. Its IUPAC name is N-methyl-2-(methylamino)-N-(1-methylsulfanylbutan-2-yl)pyridine-3-sulfonamide.
| Compound Name | N-methyl-2-(methylamino)-N-(1-methylsulfanylbutan-2-yl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 112664021 |
| Molecular Formula | C12H21N3O2S2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | N-methyl-2-(methylamino)-N-(1-methylsulfanylbutan-2-yl)pyridine-3-sulfonamide |
| SMILES | CCC(CSC)N(C)S(=O)(=O)c1cccnc1NC |
| InChI | InChI=1S/C12H21N3O2S2/c1-5-10(9-18-4)15(3)19(16,17)11-7-6-8-14-12(11)13-2/h6-8,10H,5,9H2,1-4H3,(H,13,14) |
| InChIKey | DDMQYOVAJJQUEO-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |