C11H15N5O2S — CID 64518142
N-(1H-imidazol-2-ylmethyl)-N-methyl-2-(methylamino)pyridine-3-sulfonamide (PubChem CID 64518142) has the molecular formula C11H15N5O2S and a molecular weight of 281.34 g/mol. Its IUPAC name is N-(1H-imidazol-2-ylmethyl)-N-methyl-2-(methylamino)pyridine-3-sulfonamide.
| Compound Name | N-(1H-imidazol-2-ylmethyl)-N-methyl-2-(methylamino)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 64518142 |
| Molecular Formula | C11H15N5O2S |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | N-(1H-imidazol-2-ylmethyl)-N-methyl-2-(methylamino)pyridine-3-sulfonamide |
| SMILES | CNc1ncccc1S(=O)(=O)N(C)Cc1ncc[nH]1 |
| InChI | InChI=1S/C11H15N5O2S/c1-12-11-9(4-3-5-15-11)19(17,18)16(2)8-10-13-6-7-14-10/h3-7H,8H2,1-2H3,(H,12,15)(H,13,14) |
| InChIKey | WOCNSUDWXIFUDG-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |