C16H14N2O8S — CID 10715617
4-[carboxymethyl-[(4-nitrophenyl)methyl]sulfamoyl]benzoic acid (PubChem CID 10715617) has the molecular formula C16H14N2O8S and a molecular weight of 394.36 g/mol. Its IUPAC name is 4-[carboxymethyl-[(4-nitrophenyl)methyl]sulfamoyl]benzoic acid.
| Compound Name | 4-[carboxymethyl-[(4-nitrophenyl)methyl]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 10715617 |
| Molecular Formula | C16H14N2O8S |
| Molecular Weight | 394.36 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | 4-[carboxymethyl-[(4-nitrophenyl)methyl]sulfamoyl]benzoic acid |
| SMILES | O=C(O)CN(Cc1ccc([N+](=O)[O-])cc1)S(=O)(=O)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C16H14N2O8S/c19-15(20)10-17(9-11-1-5-13(6-2-11)18(23)24)27(25,26)14-7-3-12(4-8-14)16(21)22/h1-8H,9-10H2,(H,19,20)(H,21,22) |
| InChIKey | KHAMXKWVYUSFHW-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 155.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.36 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|