C15H12ClNO4S2 — CID 91278988
(1-carbamoylcyclopenta-2,4-dien-1-yl) 5-chloro-3-methyl-1-benzothiophene-2-sulfonate (PubChem CID 91278988) has the molecular formula C15H12ClNO4S2 and a molecular weight of 369.85 g/mol. Its IUPAC name is (1-carbamoylcyclopenta-2,4-dien-1-yl) 5-chloro-3-methyl-1-benzothiophene-2-sulfonate.
| Compound Name | (1-carbamoylcyclopenta-2,4-dien-1-yl) 5-chloro-3-methyl-1-benzothiophene-2-sulfonate |
|---|---|
| PubChem CID | 91278988 |
| Molecular Formula | C15H12ClNO4S2 |
| Molecular Weight | 369.85 g/mol |
| Exact Mass | 368.99 |
| IUPAC Name | (1-carbamoylcyclopenta-2,4-dien-1-yl) 5-chloro-3-methyl-1-benzothiophene-2-sulfonate |
| SMILES | Cc1c(S(=O)(=O)OC2(C(N)=O)C=CC=C2)sc2ccc(Cl)cc12 |
| InChI | InChI=1S/C15H12ClNO4S2/c1-9-11-8-10(16)4-5-12(11)22-13(9)23(19,20)21-15(14(17)18)6-2-3-7-15/h2-8H,1H3,(H2,17,18) |
| InChIKey | IPUKUFBDENPORA-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.85 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|