C23H18ClNO5S3 — CID 12045138
N-(4-benzoyl-2-methylsulfonylphenyl)-5-chloro-3-methyl-1-benzothiophene-2-sulfonamide (PubChem CID 12045138) has the molecular formula C23H18ClNO5S3 and a molecular weight of 520.05 g/mol. Its IUPAC name is N-(4-benzoyl-2-methylsulfonylphenyl)-5-chloro-3-methyl-1-benzothiophene-2-sulfonamide.
| Compound Name | N-(4-benzoyl-2-methylsulfonylphenyl)-5-chloro-3-methyl-1-benzothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 12045138 |
| Molecular Formula | C23H18ClNO5S3 |
| Molecular Weight | 520.05 g/mol |
| Exact Mass | 519.00 |
| IUPAC Name | N-(4-benzoyl-2-methylsulfonylphenyl)-5-chloro-3-methyl-1-benzothiophene-2-sulfonamide |
| SMILES | Cc1c(S(=O)(=O)Nc2ccc(C(=O)c3ccccc3)cc2S(C)(=O)=O)sc2ccc(Cl)cc12 |
| InChI | InChI=1S/C23H18ClNO5S3/c1-14-18-13-17(24)9-11-20(18)31-23(14)33(29,30)25-19-10-8-16(12-21(19)32(2,27)28)22(26)15-6-4-3-5-7-15/h3-13,25H,1-2H3 |
| InChIKey | LMIONXRMKDZTRM-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 97.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.05 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |