C18H16ClNO6S3 — CID 141048962
6-acetyl-3-[(5-chloro-3-methyl-1-benzothiophen-2-yl)sulfonylamino]-2-methylbenzenesulfonic acid (PubChem CID 141048962) has the molecular formula C18H16ClNO6S3 and a molecular weight of 473.98 g/mol. Its IUPAC name is 6-acetyl-3-[(5-chloro-3-methyl-1-benzothiophen-2-yl)sulfonylamino]-2-methylbenzenesulfonic acid.
| Compound Name | 6-acetyl-3-[(5-chloro-3-methyl-1-benzothiophen-2-yl)sulfonylamino]-2-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 141048962 |
| Molecular Formula | C18H16ClNO6S3 |
| Molecular Weight | 473.98 g/mol |
| Exact Mass | 472.98 |
| IUPAC Name | 6-acetyl-3-[(5-chloro-3-methyl-1-benzothiophen-2-yl)sulfonylamino]-2-methylbenzenesulfonic acid |
| SMILES | CC(=O)c1ccc(NS(=O)(=O)c2sc3ccc(Cl)cc3c2C)c(C)c1S(=O)(=O)O |
| InChI | InChI=1S/C18H16ClNO6S3/c1-9-14-8-12(19)4-7-16(14)27-18(9)28(22,23)20-15-6-5-13(11(3)21)17(10(15)2)29(24,25)26/h4-8,20H,1-3H3,(H,24,25,26) |
| InChIKey | OMWXHGLESJPLQB-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 117.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.98 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|