C16H14ClNO2S2 — CID 2824261
5-chloro-3-methyl-N-(4-methylphenyl)-1-benzothiophene-2-sulfonamide (PubChem CID 2824261) has the molecular formula C16H14ClNO2S2 and a molecular weight of 351.88 g/mol. Its IUPAC name is 5-chloro-3-methyl-N-(4-methylphenyl)-1-benzothiophene-2-sulfonamide.
| Compound Name | 5-chloro-3-methyl-N-(4-methylphenyl)-1-benzothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 2824261 |
| Molecular Formula | C16H14ClNO2S2 |
| Molecular Weight | 351.88 g/mol |
| Exact Mass | 351.02 |
| IUPAC Name | 5-chloro-3-methyl-N-(4-methylphenyl)-1-benzothiophene-2-sulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2sc3ccc(Cl)cc3c2C)cc1 |
| InChI | InChI=1S/C16H14ClNO2S2/c1-10-3-6-13(7-4-10)18-22(19,20)16-11(2)14-9-12(17)5-8-15(14)21-16/h3-9,18H,1-2H3 |
| InChIKey | NCWXYBRSDAYPSP-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.88 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |