C23H22ClN3O4S2 — CID 11720304
2-[5-[(5-chloro-3-methyl-1-benzothiophen-2-yl)sulfonylamino]-1H-indol-3-yl]-N,N-diethyl-2-oxoacetamide (PubChem CID 11720304) has the molecular formula C23H22ClN3O4S2 and a molecular weight of 504.03 g/mol. Its IUPAC name is 2-[5-[(5-chloro-3-methyl-1-benzothiophen-2-yl)sulfonylamino]-1H-indol-3-yl]-N,N-diethyl-2-oxoacetamide.
| Compound Name | 2-[5-[(5-chloro-3-methyl-1-benzothiophen-2-yl)sulfonylamino]-1H-indol-3-yl]-N,N-diethyl-2-oxoacetamide |
|---|---|
| PubChem CID | 11720304 |
| Molecular Formula | C23H22ClN3O4S2 |
| Molecular Weight | 504.03 g/mol |
| Exact Mass | 503.07 |
| IUPAC Name | 2-[5-[(5-chloro-3-methyl-1-benzothiophen-2-yl)sulfonylamino]-1H-indol-3-yl]-N,N-diethyl-2-oxoacetamide |
| SMILES | CCN(CC)C(=O)C(=O)c1c[nH]c2ccc(NS(=O)(=O)c3sc4ccc(Cl)cc4c3C)cc12 |
| InChI | InChI=1S/C23H22ClN3O4S2/c1-4-27(5-2)22(29)21(28)18-12-25-19-8-7-15(11-17(18)19)26-33(30,31)23-13(3)16-10-14(24)6-9-20(16)32-23/h6-12,25-26H,4-5H2,1-3H3 |
| InChIKey | ZCXXDKRSPJOVSZ-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 99.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.03 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|