C22H19N3O4S — CID 11510027
N,N-dimethyl-2-[5-(naphthalen-1-ylsulfonylamino)-1H-indol-3-yl]-2-oxoacetamide (PubChem CID 11510027) has the molecular formula C22H19N3O4S and a molecular weight of 421.48 g/mol. Its IUPAC name is N,N-dimethyl-2-[5-(naphthalen-1-ylsulfonylamino)-1H-indol-3-yl]-2-oxoacetamide.
| Compound Name | N,N-dimethyl-2-[5-(naphthalen-1-ylsulfonylamino)-1H-indol-3-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 11510027 |
| Molecular Formula | C22H19N3O4S |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | N,N-dimethyl-2-[5-(naphthalen-1-ylsulfonylamino)-1H-indol-3-yl]-2-oxoacetamide |
| SMILES | CN(C)C(=O)C(=O)c1c[nH]c2ccc(NS(=O)(=O)c3cccc4ccccc34)cc12 |
| InChI | InChI=1S/C22H19N3O4S/c1-25(2)22(27)21(26)18-13-23-19-11-10-15(12-17(18)19)24-30(28,29)20-9-5-7-14-6-3-4-8-16(14)20/h3-13,23-24H,1-2H3 |
| InChIKey | ADFJMEPCVOWVDB-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 99.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|