C21H22N4O2S — CID 10294044
N-[3-[2-(dimethylamino)ethyl]-1H-indol-5-yl]quinoline-8-sulfonamide (PubChem CID 10294044) has the molecular formula C21H22N4O2S and a molecular weight of 394.50 g/mol. Its IUPAC name is N-[3-[2-(dimethylamino)ethyl]-1H-indol-5-yl]quinoline-8-sulfonamide.
| Compound Name | N-[3-[2-(dimethylamino)ethyl]-1H-indol-5-yl]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 10294044 |
| Molecular Formula | C21H22N4O2S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | N-[3-[2-(dimethylamino)ethyl]-1H-indol-5-yl]quinoline-8-sulfonamide |
| SMILES | CN(C)CCc1c[nH]c2ccc(NS(=O)(=O)c3cccc4cccnc34)cc12 |
| InChI | InChI=1S/C21H22N4O2S/c1-25(2)12-10-16-14-23-19-9-8-17(13-18(16)19)24-28(26,27)20-7-3-5-15-6-4-11-22-21(15)20/h3-9,11,13-14,23-24H,10,12H2,1-2H3 |
| InChIKey | XPRKZGSAGJCUOL-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |