C21H23N5O2S2 — CID 69262700
3-[2-(dimethylamino)ethyl]-N-[(5-pyridin-2-ylthiophen-2-yl)sulfamoyl]-1H-indol-5-amine (PubChem CID 69262700) has the molecular formula C21H23N5O2S2 and a molecular weight of 441.58 g/mol. Its IUPAC name is 3-[2-(dimethylamino)ethyl]-N-[(5-pyridin-2-ylthiophen-2-yl)sulfamoyl]-1H-indol-5-amine.
| Compound Name | 3-[2-(dimethylamino)ethyl]-N-[(5-pyridin-2-ylthiophen-2-yl)sulfamoyl]-1H-indol-5-amine |
|---|---|
| PubChem CID | 69262700 |
| Molecular Formula | C21H23N5O2S2 |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | 3-[2-(dimethylamino)ethyl]-N-[(5-pyridin-2-ylthiophen-2-yl)sulfamoyl]-1H-indol-5-amine |
| SMILES | CN(C)CCc1c[nH]c2ccc(NS(=O)(=O)Nc3ccc(-c4ccccn4)s3)cc12 |
| InChI | InChI=1S/C21H23N5O2S2/c1-26(2)12-10-15-14-23-18-7-6-16(13-17(15)18)24-30(27,28)25-21-9-8-20(29-21)19-5-3-4-11-22-19/h3-9,11,13-14,23-25H,10,12H2,1-2H3 |
| InChIKey | NUSDHZVSCNMLPN-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfonamide_E(2)', 'substructure': 'N/A'} |
|---|