C21H23N5O2S — CID 69262416
N-[[3-[2-(dimethylamino)ethyl]-1H-indol-5-yl]sulfamoyl]quinolin-8-amine (PubChem CID 69262416) has the molecular formula C21H23N5O2S and a molecular weight of 409.52 g/mol. Its IUPAC name is N-[[3-[2-(dimethylamino)ethyl]-1H-indol-5-yl]sulfamoyl]quinolin-8-amine.
| Compound Name | N-[[3-[2-(dimethylamino)ethyl]-1H-indol-5-yl]sulfamoyl]quinolin-8-amine |
|---|---|
| PubChem CID | 69262416 |
| Molecular Formula | C21H23N5O2S |
| Molecular Weight | 409.52 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | N-[[3-[2-(dimethylamino)ethyl]-1H-indol-5-yl]sulfamoyl]quinolin-8-amine |
| SMILES | CN(C)CCc1c[nH]c2ccc(NS(=O)(=O)Nc3cccc4cccnc34)cc12 |
| InChI | InChI=1S/C21H23N5O2S/c1-26(2)12-10-16-14-23-19-9-8-17(13-18(16)19)24-29(27,28)25-20-7-3-5-15-6-4-11-22-21(15)20/h3-9,11,13-14,23-25H,10,12H2,1-2H3 |
| InChIKey | KASFZWCMEGYDPF-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.52 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfonamide_E(2)', 'substructure': 'N/A'} |
|---|