C19H17N3O3S — CID 5228855
N-[2-(5-hydroxy-1H-indol-3-yl)ethyl]quinoline-8-sulfonamide (PubChem CID 5228855) has the molecular formula C19H17N3O3S and a molecular weight of 367.43 g/mol. Its IUPAC name is N-[2-(5-hydroxy-1H-indol-3-yl)ethyl]quinoline-8-sulfonamide.
| Compound Name | N-[2-(5-hydroxy-1H-indol-3-yl)ethyl]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 5228855 |
| Molecular Formula | C19H17N3O3S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | N-[2-(5-hydroxy-1H-indol-3-yl)ethyl]quinoline-8-sulfonamide |
| SMILES | O=S(=O)(NCCc1c[nH]c2ccc(O)cc12)c1cccc2cccnc12 |
| InChI | InChI=1S/C19H17N3O3S/c23-15-6-7-17-16(11-15)14(12-21-17)8-10-22-26(24,25)18-5-1-3-13-4-2-9-20-19(13)18/h1-7,9,11-12,21-23H,8,10H2 |
| InChIKey | BFJXVCUOGAZFTO-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |