C13H18N4S — CID 19040763
[3-[2-(dimethylamino)ethyl]-1H-indol-5-yl]thiourea (PubChem CID 19040763) has the molecular formula C13H18N4S and a molecular weight of 262.38 g/mol. Its IUPAC name is [3-[2-(dimethylamino)ethyl]-1H-indol-5-yl]thiourea.
| Compound Name | [3-[2-(dimethylamino)ethyl]-1H-indol-5-yl]thiourea |
|---|---|
| PubChem CID | 19040763 |
| Molecular Formula | C13H18N4S |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | [3-[2-(dimethylamino)ethyl]-1H-indol-5-yl]thiourea |
| SMILES | CN(C)CCc1c[nH]c2ccc(NC(N)=S)cc12 |
| InChI | InChI=1S/C13H18N4S/c1-17(2)6-5-9-8-15-12-4-3-10(7-11(9)12)16-13(14)18/h3-4,7-8,15H,5-6H2,1-2H3,(H3,14,16,18) |
| InChIKey | AHVCDINGNINIJM-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 57.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|