C11H10N4S — CID 12803108
[3-(cyanomethyl)-1H-indol-5-yl]thiourea (PubChem CID 12803108) has the molecular formula C11H10N4S and a molecular weight of 230.30 g/mol. Its IUPAC name is [3-(cyanomethyl)-1H-indol-5-yl]thiourea.
| Compound Name | [3-(cyanomethyl)-1H-indol-5-yl]thiourea |
|---|---|
| PubChem CID | 12803108 |
| Molecular Formula | C11H10N4S |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | [3-(cyanomethyl)-1H-indol-5-yl]thiourea |
| SMILES | N#CCc1c[nH]c2ccc(NC(N)=S)cc12 |
| InChI | InChI=1S/C11H10N4S/c12-4-3-7-6-14-10-2-1-8(5-9(7)10)15-11(13)16/h1-2,5-6,14H,3H2,(H3,13,15,16) |
| InChIKey | MKGWGMJMQWCRCF-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 77.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|