C13H14N4O — CID 70396619
3-[3-(cyanomethyl)-1H-indol-5-yl]-1,1-dimethylurea (PubChem CID 70396619) has the molecular formula C13H14N4O and a molecular weight of 242.28 g/mol. Its IUPAC name is 3-[3-(cyanomethyl)-1H-indol-5-yl]-1,1-dimethylurea.
| Compound Name | 3-[3-(cyanomethyl)-1H-indol-5-yl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 70396619 |
| Molecular Formula | C13H14N4O |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 3-[3-(cyanomethyl)-1H-indol-5-yl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)Nc1ccc2[nH]cc(CC#N)c2c1 |
| InChI | InChI=1S/C13H14N4O/c1-17(2)13(18)16-10-3-4-12-11(7-10)9(5-6-14)8-15-12/h3-4,7-8,15H,5H2,1-2H3,(H,16,18) |
| InChIKey | UYMVWOCLPZVUGX-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 71.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |