C17H15N5O2 — CID 166366025
ethyl 2-[[3-(cyanomethyl)-1H-indol-5-yl]amino]pyrimidine-5-carboxylate (PubChem CID 166366025) has the molecular formula C17H15N5O2 and a molecular weight of 321.34 g/mol. Its IUPAC name is ethyl 2-[[3-(cyanomethyl)-1H-indol-5-yl]amino]pyrimidine-5-carboxylate.
| Compound Name | ethyl 2-[[3-(cyanomethyl)-1H-indol-5-yl]amino]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 166366025 |
| Molecular Formula | C17H15N5O2 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | ethyl 2-[[3-(cyanomethyl)-1H-indol-5-yl]amino]pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(Nc2ccc3[nH]cc(CC#N)c3c2)nc1 |
| InChI | InChI=1S/C17H15N5O2/c1-2-24-16(23)12-9-20-17(21-10-12)22-13-3-4-15-14(7-13)11(5-6-18)8-19-15/h3-4,7-10,19H,2,5H2,1H3,(H,20,21,22) |
| InChIKey | AJTRAXYDRMIJIT-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 103.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |